C21H16Br2N2O4 — CID 98277845
(1R,2S,6S,7R,8S,9S)-8,9-dibromo-4-[4-(4-nitrophenyl)phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 98277845) has the molecular formula C21H16Br2N2O4 and a molecular weight of 520.18 g/mol. Its IUPAC name is (1R,2S,6S,7R,8S,9S)-8,9-dibromo-4-[4-(4-nitrophenyl)phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2S,6S,7R,8S,9S)-8,9-dibromo-4-[4-(4-nitrophenyl)phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 98277845 |
| Molecular Formula | C21H16Br2N2O4 |
| Molecular Weight | 520.18 g/mol |
| Exact Mass | 517.95 |
| IUPAC Name | (1R,2S,6S,7R,8S,9S)-8,9-dibromo-4-[4-(4-nitrophenyl)phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H]3C[C@@H]([C@H](Br)[C@H]3Br)[C@H]2C(=O)N1c1ccc(-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C21H16Br2N2O4/c22-18-14-9-15(19(18)23)17-16(14)20(26)24(21(17)27)12-5-1-10(2-6-12)11-3-7-13(8-4-11)25(28)29/h1-8,14-19H,9H2/t14-,15-,16-,17-,18+,19+/m1/s1 |
| InChIKey | VASKOMIOHAYDFL-QMROVXIMSA-N |
| XLogP | 4.54 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.18 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|