C20H27N5OS — CID 98283959
2-[(4-methyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide (PubChem CID 98283959) has the molecular formula C20H27N5OS and a molecular weight of 385.54 g/mol. Its IUPAC name is 2-[(4-methyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide.
| Compound Name | 2-[(4-methyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide |
|---|---|
| PubChem CID | 98283959 |
| Molecular Formula | C20H27N5OS |
| Molecular Weight | 385.54 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 2-[(4-methyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-N-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]acetamide |
| SMILES | Cn1c(SCC(=O)N[C@@H]2C[C@H]3CC[C@@]2(C)C3(C)C)nnc1-c1ccncc1 |
| InChI | InChI=1S/C20H27N5OS/c1-19(2)14-5-8-20(19,3)15(11-14)22-16(26)12-27-18-24-23-17(25(18)4)13-6-9-21-10-7-13/h6-7,9-10,14-15H,5,8,11-12H2,1-4H3,(H,22,26)/t14-,15-,20-/m1/s1 |
| InChIKey | YHKLZSWPZCBEOX-STXHMFSFSA-N |
| XLogP | 3.30 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |