C23H20N2O4 — CID 98284537
4-[(1S,2R,6S,7R,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-N-(furan-2-ylmethyl)benzamide (PubChem CID 98284537) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is 4-[(1S,2R,6S,7R,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 4-[(1S,2R,6S,7R,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 98284537 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 4-[(1S,2R,6S,7R,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-N-(furan-2-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccco1)c1ccc(N2C(=O)[C@@H]3[C@H]4C=C[C@H]([C@H]5C[C@H]45)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C23H20N2O4/c26-21(24-11-14-2-1-9-29-14)12-3-5-13(6-4-12)25-22(27)19-15-7-8-16(18-10-17(15)18)20(19)23(25)28/h1-9,15-20H,10-11H2,(H,24,26)/t15-,16+,17-,18-,19+,20-/m1/s1 |
| InChIKey | PMCXEGKYIKKDNM-RKGSWTEASA-N |
| XLogP | 2.77 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|