C18H21ClN2O5 — CID 98289805
(1S,2S,3R,4S)-3-[[[2-(4-chloro-3-methylphenoxy)acetyl]amino]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 98289805) has the molecular formula C18H21ClN2O5 and a molecular weight of 380.83 g/mol. Its IUPAC name is (1S,2S,3R,4S)-3-[[[2-(4-chloro-3-methylphenoxy)acetyl]amino]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1S,2S,3R,4S)-3-[[[2-(4-chloro-3-methylphenoxy)acetyl]amino]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 98289805 |
| Molecular Formula | C18H21ClN2O5 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | (1S,2S,3R,4S)-3-[[[2-(4-chloro-3-methylphenoxy)acetyl]amino]carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | Cc1cc(OCC(=O)NNC(=O)[C@@H]2[C@H]3CC[C@@H](C3)[C@@H]2C(=O)O)ccc1Cl |
| InChI | InChI=1S/C18H21ClN2O5/c1-9-6-12(4-5-13(9)19)26-8-14(22)20-21-17(23)15-10-2-3-11(7-10)16(15)18(24)25/h4-6,10-11,15-16H,2-3,7-8H2,1H3,(H,20,22)(H,21,23)(H,24,25)/t10-,11-,15+,16-/m0/s1 |
| InChIKey | ZJHXZAWJJOOHEP-QMMBQJITSA-N |
| XLogP | 1.92 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|