C21H20N2O7S — CID 98299597
(1S,2R,3R,4S)-3-[[3-(1,3-benzodioxol-5-ylmethylcarbamoyl)thiophen-2-yl]carbamoyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 98299597) has the molecular formula C21H20N2O7S and a molecular weight of 444.47 g/mol. Its IUPAC name is (1S,2R,3R,4S)-3-[[3-(1,3-benzodioxol-5-ylmethylcarbamoyl)thiophen-2-yl]carbamoyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1S,2R,3R,4S)-3-[[3-(1,3-benzodioxol-5-ylmethylcarbamoyl)thiophen-2-yl]carbamoyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 98299597 |
| Molecular Formula | C21H20N2O7S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | (1S,2R,3R,4S)-3-[[3-(1,3-benzodioxol-5-ylmethylcarbamoyl)thiophen-2-yl]carbamoyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1ccsc1NC(=O)[C@@H]1[C@@H](C(=O)O)[C@@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C21H20N2O7S/c24-18(22-8-10-1-2-12-15(7-10)29-9-28-12)11-5-6-31-20(11)23-19(25)16-13-3-4-14(30-13)17(16)21(26)27/h1-2,5-7,13-14,16-17H,3-4,8-9H2,(H,22,24)(H,23,25)(H,26,27)/t13-,14-,16-,17-/m0/s1 |
| InChIKey | VAWQIHGWOSEKLB-OTRWWLKZSA-N |
| XLogP | 2.22 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |