C19H18N2O5S — CID 98299948
(1R,2S,3R,4R)-3-[[3-(furan-2-ylmethylcarbamoyl)thiophen-2-yl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 98299948) has the molecular formula C19H18N2O5S and a molecular weight of 386.43 g/mol. Its IUPAC name is (1R,2S,3R,4R)-3-[[3-(furan-2-ylmethylcarbamoyl)thiophen-2-yl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2S,3R,4R)-3-[[3-(furan-2-ylmethylcarbamoyl)thiophen-2-yl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 98299948 |
| Molecular Formula | C19H18N2O5S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | (1R,2S,3R,4R)-3-[[3-(furan-2-ylmethylcarbamoyl)thiophen-2-yl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(NCc1ccco1)c1ccsc1NC(=O)[C@H]1[C@@H](C(=O)O)[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C19H18N2O5S/c22-16(20-9-12-2-1-6-26-12)13-5-7-27-18(13)21-17(23)14-10-3-4-11(8-10)15(14)19(24)25/h1-7,10-11,14-15H,8-9H2,(H,20,22)(H,21,23)(H,24,25)/t10-,11-,14+,15-/m0/s1 |
| InChIKey | KJDXXVXBZRNICE-AZHAFVHUSA-N |
| XLogP | 2.73 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|