C22H23N3O5S — CID 98303821
[2-[(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)amino]-2-oxoethyl] 2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate (PubChem CID 98303821) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is [2-[(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)amino]-2-oxoethyl] 2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate.
| Compound Name | [2-[(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)amino]-2-oxoethyl] 2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate |
|---|---|
| PubChem CID | 98303821 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | [2-[(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)amino]-2-oxoethyl] 2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate |
| SMILES | N#Cc1c(NC(=O)COC(=O)CN2C(=O)[C@H]3CC=CC[C@@H]3C2=O)sc2c1CCCCC2 |
| InChI | InChI=1S/C22H23N3O5S/c23-10-16-13-6-2-1-3-9-17(13)31-20(16)24-18(26)12-30-19(27)11-25-21(28)14-7-4-5-8-15(14)22(25)29/h4-5,14-15H,1-3,6-9,11-12H2,(H,24,26)/t14-,15-/m0/s1 |
| InChIKey | NUCGURZPRZYDBF-GJZGRUSLSA-N |
| XLogP | 2.32 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|