C24H30N2O7S — CID 3917814
propan-2-yl 2-[[2-[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]oxyacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 3917814) has the molecular formula C24H30N2O7S and a molecular weight of 490.58 g/mol. Its IUPAC name is propan-2-yl 2-[[2-[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]oxyacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | propan-2-yl 2-[[2-[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]oxyacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3917814 |
| Molecular Formula | C24H30N2O7S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | propan-2-yl 2-[[2-[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]oxyacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CC(C)OC(=O)c1c(NC(=O)COC(=O)CN2C(=O)C3CCCCC3C2=O)sc2c1CCCC2 |
| InChI | InChI=1S/C24H30N2O7S/c1-13(2)33-24(31)20-16-9-5-6-10-17(16)34-21(20)25-18(27)12-32-19(28)11-26-22(29)14-7-3-4-8-15(14)23(26)30/h13-15H,3-12H2,1-2H3,(H,25,27) |
| InChIKey | YWYDTVQZLYLZCI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|