C23H18Cl4N2O7S — CID 7903598
ethyl 2-[[2-[2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)acetyl]oxyacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 7903598) has the molecular formula C23H18Cl4N2O7S and a molecular weight of 608.28 g/mol. Its IUPAC name is ethyl 2-[[2-[2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)acetyl]oxyacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)acetyl]oxyacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 7903598 |
| Molecular Formula | C23H18Cl4N2O7S |
| Molecular Weight | 608.28 g/mol |
| Exact Mass | 605.96 |
| IUPAC Name | ethyl 2-[[2-[2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)acetyl]oxyacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COC(=O)CN2C(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C2=O)sc2c1CCCC2 |
| InChI | InChI=1S/C23H18Cl4N2O7S/c1-2-35-23(34)13-9-5-3-4-6-10(9)37-20(13)28-11(30)8-36-12(31)7-29-21(32)14-15(22(29)33)17(25)19(27)18(26)16(14)24/h2-8H2,1H3,(H,28,30) |
| InChIKey | XBGOORMYZICKNL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.28 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|