C24H20Cl4N2O7S — CID 99656488
ethyl 2-[[2-[(2S)-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoyl]oxyacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 99656488) has the molecular formula C24H20Cl4N2O7S and a molecular weight of 622.31 g/mol. Its IUPAC name is ethyl 2-[[2-[(2S)-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoyl]oxyacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[(2S)-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoyl]oxyacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 99656488 |
| Molecular Formula | C24H20Cl4N2O7S |
| Molecular Weight | 622.31 g/mol |
| Exact Mass | 619.97 |
| IUPAC Name | ethyl 2-[[2-[(2S)-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)propanoyl]oxyacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COC(=O)[C@H](C)N2C(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C2=O)sc2c1CCCC2 |
| InChI | InChI=1S/C24H20Cl4N2O7S/c1-3-36-24(35)13-10-6-4-5-7-11(10)38-20(13)29-12(31)8-37-23(34)9(2)30-21(32)14-15(22(30)33)17(26)19(28)18(27)16(14)25/h9H,3-8H2,1-2H3,(H,29,31)/t9-/m0/s1 |
| InChIKey | OYIXZMRRDONYJL-VIFPVBQESA-N |
| XLogP | 5.58 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.31 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|