C25H33N3O3 — CID 98314418
[(2S)-1-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]amino]-1-oxopropan-2-yl] 2-methyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylate (PubChem CID 98314418) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is [(2S)-1-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]amino]-1-oxopropan-2-yl] 2-methyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylate.
| Compound Name | [(2S)-1-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]amino]-1-oxopropan-2-yl] 2-methyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylate |
|---|---|
| PubChem CID | 98314418 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | [(2S)-1-[[(1R,2S,3S)-2,3-dimethylcyclohexyl]amino]-1-oxopropan-2-yl] 2-methyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine-10-carboxylate |
| SMILES | C[C@H]1[C@@H](C)CCC[C@H]1NC(=O)[C@H](C)OC(=O)c1c2c(nc3ccccc13)CCN(C)C2 |
| InChI | InChI=1S/C25H33N3O3/c1-15-8-7-11-20(16(15)2)27-24(29)17(3)31-25(30)23-18-9-5-6-10-21(18)26-22-12-13-28(4)14-19(22)23/h5-6,9-10,15-17,20H,7-8,11-14H2,1-4H3,(H,27,29)/t15-,16-,17-,20+/m0/s1 |
| InChIKey | HRVHXBQIXOYFAS-OGNFBWPZSA-N |
| XLogP | 3.71 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |