C25H32N2O3 — CID 11893288
[2-[[(1S,2R,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline-11-carboxylate (PubChem CID 11893288) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is [2-[[(1S,2R,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline-11-carboxylate.
| Compound Name | [2-[[(1S,2R,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline-11-carboxylate |
|---|---|
| PubChem CID | 11893288 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | [2-[[(1S,2R,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline-11-carboxylate |
| SMILES | C[C@H]1[C@@H](NC(=O)COC(=O)c2c3c(nc4ccccc24)CCCCC3)CCC[C@@H]1C |
| InChI | InChI=1S/C25H32N2O3/c1-16-9-8-14-20(17(16)2)27-23(28)15-30-25(29)24-18-10-4-3-5-12-21(18)26-22-13-7-6-11-19(22)24/h6-7,11,13,16-17,20H,3-5,8-10,12,14-15H2,1-2H3,(H,27,28)/t16-,17+,20-/m0/s1 |
| InChIKey | XKORNCNHUYENOO-QKLQHJQFSA-N |
| XLogP | 4.60 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |