C26H18ClFN2O3S — CID 98319527
(4E,5R)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-(2-fluorophenyl)pyrrolidine-2,3-dione (PubChem CID 98319527) has the molecular formula C26H18ClFN2O3S and a molecular weight of 492.96 g/mol. Its IUPAC name is (4E,5R)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-(2-fluorophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E,5R)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-(2-fluorophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98319527 |
| Molecular Formula | C26H18ClFN2O3S |
| Molecular Weight | 492.96 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | (4E,5R)-4-[(4-chlorophenyl)-hydroxymethylidene]-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-(2-fluorophenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1cc(C)c2nc(N3C(=O)C(=O)/C(=C(/O)c4ccc(Cl)cc4)[C@@H]3c3ccccc3F)sc2c1 |
| InChI | InChI=1S/C26H18ClFN2O3S/c1-13-11-14(2)21-19(12-13)34-26(29-21)30-22(17-5-3-4-6-18(17)28)20(24(32)25(30)33)23(31)15-7-9-16(27)10-8-15/h3-12,22,31H,1-2H3/b23-20+/t22-/m0/s1 |
| InChIKey | NFOLWCXRDJLDRQ-HFEWCJDKSA-N |
| XLogP | 6.33 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.96 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|