C36H28ClNO4 — CID 98325426
(1S,2R,3aR)-1-(4-chlorobenzoyl)-2-(2-ethoxyphenyl)-7-methylspiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione (PubChem CID 98325426) has the molecular formula C36H28ClNO4 and a molecular weight of 574.08 g/mol. Its IUPAC name is (1S,2R,3aR)-1-(4-chlorobenzoyl)-2-(2-ethoxyphenyl)-7-methylspiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione.
| Compound Name | (1S,2R,3aR)-1-(4-chlorobenzoyl)-2-(2-ethoxyphenyl)-7-methylspiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 98325426 |
| Molecular Formula | C36H28ClNO4 |
| Molecular Weight | 574.08 g/mol |
| Exact Mass | 573.17 |
| IUPAC Name | (1S,2R,3aR)-1-(4-chlorobenzoyl)-2-(2-ethoxyphenyl)-7-methylspiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
| SMILES | CCOc1ccccc1[C@H]1[C@@H](C(=O)c2ccc(Cl)cc2)N2c3ccc(C)cc3C=C[C@@H]2C12C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C36H28ClNO4/c1-3-42-29-11-7-6-10-27(29)31-32(33(39)22-13-16-24(37)17-14-22)38-28-18-12-21(2)20-23(28)15-19-30(38)36(31)34(40)25-8-4-5-9-26(25)35(36)41/h4-20,30-32H,3H2,1-2H3/t30-,31+,32+/m1/s1 |
| InChIKey | NYEVIRDTHGCRLA-RTOKGZNSSA-N |
| XLogP | 7.36 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.08 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|