C33H32N2O8S — CID 98326856
(4E,5S)-5-(4-butoxy-3-methoxyphenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(6-ethoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 98326856) has the molecular formula C33H32N2O8S and a molecular weight of 616.69 g/mol. Its IUPAC name is (4E,5S)-5-(4-butoxy-3-methoxyphenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(6-ethoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-5-(4-butoxy-3-methoxyphenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(6-ethoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98326856 |
| Molecular Formula | C33H32N2O8S |
| Molecular Weight | 616.69 g/mol |
| Exact Mass | 616.19 |
| IUPAC Name | (4E,5S)-5-(4-butoxy-3-methoxyphenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(6-ethoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | CCCCOc1ccc([C@H]2/C(=C(\O)c3ccc4c(c3)OCCO4)C(=O)C(=O)N2c2nc3ccc(OCC)cc3s2)cc1OC |
| InChI | InChI=1S/C33H32N2O8S/c1-4-6-13-41-23-11-7-19(16-25(23)39-3)29-28(30(36)20-8-12-24-26(17-20)43-15-14-42-24)31(37)32(38)35(29)33-34-22-10-9-21(40-5-2)18-27(22)44-33/h7-12,16-18,29,36H,4-6,13-15H2,1-3H3/b30-28+/t29-/m0/s1 |
| InChIKey | QHEKTAGIIFEHHU-MIOXIQPJSA-N |
| XLogP | 6.28 |
| TPSA | 116.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.69 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|