C32H29ClN2O7S — CID 98376882
(4E,5S)-1-(6-chloro-1,3-benzothiazol-2-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(3-methoxy-4-pentoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 98376882) has the molecular formula C32H29ClN2O7S and a molecular weight of 621.11 g/mol. Its IUPAC name is (4E,5S)-1-(6-chloro-1,3-benzothiazol-2-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(3-methoxy-4-pentoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-1-(6-chloro-1,3-benzothiazol-2-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(3-methoxy-4-pentoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98376882 |
| Molecular Formula | C32H29ClN2O7S |
| Molecular Weight | 621.11 g/mol |
| Exact Mass | 620.14 |
| IUPAC Name | (4E,5S)-1-(6-chloro-1,3-benzothiazol-2-yl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(3-methoxy-4-pentoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCCCOc1ccc([C@H]2/C(=C(\O)c3ccc4c(c3)OCCO4)C(=O)C(=O)N2c2nc3ccc(Cl)cc3s2)cc1OC |
| InChI | InChI=1S/C32H29ClN2O7S/c1-3-4-5-12-40-22-10-6-18(15-24(22)39-2)28-27(29(36)19-7-11-23-25(16-19)42-14-13-41-23)30(37)31(38)35(28)32-34-21-9-8-20(33)17-26(21)43-32/h6-11,15-17,28,36H,3-5,12-14H2,1-2H3/b29-27+/t28-/m0/s1 |
| InChIKey | ALLZZIQAGJZKAE-TXTDGAROSA-N |
| XLogP | 6.92 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.11 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|