C32H32N6O2 — CID 98330459
(9S)-9-[4-(dimethylamino)phenyl]-N-(3-methoxyphenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide (PubChem CID 98330459) has the molecular formula C32H32N6O2 and a molecular weight of 532.65 g/mol. Its IUPAC name is (9S)-9-[4-(dimethylamino)phenyl]-N-(3-methoxyphenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide.
| Compound Name | (9S)-9-[4-(dimethylamino)phenyl]-N-(3-methoxyphenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 98330459 |
| Molecular Formula | C32H32N6O2 |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | (9S)-9-[4-(dimethylamino)phenyl]-N-(3-methoxyphenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
| SMILES | COc1cccc(NC(=O)N2Cc3c(C)nn(-c4ccccc4)c3-n3cccc3[C@@H]2c2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C32H32N6O2/c1-22-28-21-37(32(39)33-24-10-8-13-27(20-24)40-4)30(23-15-17-25(18-16-23)35(2)3)29-14-9-19-36(29)31(28)38(34-22)26-11-6-5-7-12-26/h5-20,30H,21H2,1-4H3,(H,33,39)/t30-/m0/s1 |
| InChIKey | CTQKEDBGCCKFSH-PMERELPUSA-N |
| XLogP | 6.18 |
| TPSA | 67.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|