C32H29N5O3 — CID 98330507
ethyl 2-[[(9R)-5-methyl-3,9-diphenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carbonyl]amino]benzoate (PubChem CID 98330507) has the molecular formula C32H29N5O3 and a molecular weight of 531.62 g/mol. Its IUPAC name is ethyl 2-[[(9R)-5-methyl-3,9-diphenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carbonyl]amino]benzoate.
| Compound Name | ethyl 2-[[(9R)-5-methyl-3,9-diphenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 98330507 |
| Molecular Formula | C32H29N5O3 |
| Molecular Weight | 531.62 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | ethyl 2-[[(9R)-5-methyl-3,9-diphenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)N1Cc2c(C)nn(-c3ccccc3)c2-n2cccc2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C32H29N5O3/c1-3-40-31(38)25-17-10-11-18-27(25)33-32(39)36-21-26-22(2)34-37(24-15-8-5-9-16-24)30(26)35-20-12-19-28(35)29(36)23-13-6-4-7-14-23/h4-20,29H,3,21H2,1-2H3,(H,33,39)/t29-/m1/s1 |
| InChIKey | PNBYSWNMIYRUNR-GDLZYMKVSA-N |
| XLogP | 6.29 |
| TPSA | 81.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.62 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |