C33H31N5O3 — CID 98330648
methyl 3-[[(9R)-5-ethyl-9-(4-methylphenyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carbonyl]amino]benzoate (PubChem CID 98330648) has the molecular formula C33H31N5O3 and a molecular weight of 545.64 g/mol. Its IUPAC name is methyl 3-[[(9R)-5-ethyl-9-(4-methylphenyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carbonyl]amino]benzoate.
| Compound Name | methyl 3-[[(9R)-5-ethyl-9-(4-methylphenyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 98330648 |
| Molecular Formula | C33H31N5O3 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | methyl 3-[[(9R)-5-ethyl-9-(4-methylphenyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carbonyl]amino]benzoate |
| SMILES | CCc1nn(-c2ccccc2)c2c1CN(C(=O)Nc1cccc(C(=O)OC)c1)[C@H](c1ccc(C)cc1)c1cccn1-2 |
| InChI | InChI=1S/C33H31N5O3/c1-4-28-27-21-37(33(40)34-25-11-8-10-24(20-25)32(39)41-3)30(23-17-15-22(2)16-18-23)29-14-9-19-36(29)31(27)38(35-28)26-12-6-5-7-13-26/h5-20,30H,4,21H2,1-3H3,(H,34,40)/t30-/m1/s1 |
| InChIKey | BXUWIFAOVKQXPR-SSEXGKCCSA-N |
| XLogP | 6.46 |
| TPSA | 81.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |