C32H31N5O3 — CID 98330933
(9R)-5-ethyl-N,9-bis(3-methoxyphenyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide (PubChem CID 98330933) has the molecular formula C32H31N5O3 and a molecular weight of 533.63 g/mol. Its IUPAC name is (9R)-5-ethyl-N,9-bis(3-methoxyphenyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide.
| Compound Name | (9R)-5-ethyl-N,9-bis(3-methoxyphenyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 98330933 |
| Molecular Formula | C32H31N5O3 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | (9R)-5-ethyl-N,9-bis(3-methoxyphenyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
| SMILES | CCc1nn(-c2ccccc2)c2c1CN(C(=O)Nc1cccc(OC)c1)[C@H](c1cccc(OC)c1)c1cccn1-2 |
| InChI | InChI=1S/C32H31N5O3/c1-4-28-27-21-36(32(38)33-23-12-9-16-26(20-23)40-3)30(22-11-8-15-25(19-22)39-2)29-17-10-18-35(29)31(27)37(34-28)24-13-6-5-7-14-24/h5-20,30H,4,21H2,1-3H3,(H,33,38)/t30-/m1/s1 |
| InChIKey | KWXOWFPGODQUGY-SSEXGKCCSA-N |
| XLogP | 6.38 |
| TPSA | 73.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |