C26H27N5O2 — CID 92867298
(9S)-5-ethyl-9-(3-methoxyphenyl)-N-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide (PubChem CID 92867298) has the molecular formula C26H27N5O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is (9S)-5-ethyl-9-(3-methoxyphenyl)-N-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide.
| Compound Name | (9S)-5-ethyl-9-(3-methoxyphenyl)-N-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92867298 |
| Molecular Formula | C26H27N5O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | (9S)-5-ethyl-9-(3-methoxyphenyl)-N-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
| SMILES | CCc1nn(-c2ccccc2)c2c1CN(C(=O)NC)[C@@H](c1cccc(OC)c1)c1cccn1-2 |
| InChI | InChI=1S/C26H27N5O2/c1-4-22-21-17-30(26(32)27-2)24(18-10-8-13-20(16-18)33-3)23-14-9-15-29(23)25(21)31(28-22)19-11-6-5-7-12-19/h5-16,24H,4,17H2,1-3H3,(H,27,32)/t24-/m0/s1 |
| InChIKey | UWLUDKUUYSPDDQ-DEOSSOPVSA-N |
| XLogP | 4.48 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |