C27H29N5O — CID 92892352
(9R)-5-ethyl-3,9-diphenyl-N-propyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide (PubChem CID 92892352) has the molecular formula C27H29N5O and a molecular weight of 439.56 g/mol. Its IUPAC name is (9R)-5-ethyl-3,9-diphenyl-N-propyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide.
| Compound Name | (9R)-5-ethyl-3,9-diphenyl-N-propyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92892352 |
| Molecular Formula | C27H29N5O |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | (9R)-5-ethyl-3,9-diphenyl-N-propyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
| SMILES | CCCNC(=O)N1Cc2c(CC)nn(-c3ccccc3)c2-n2cccc2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C27H29N5O/c1-3-17-28-27(33)31-19-22-23(4-2)29-32(21-14-9-6-10-15-21)26(22)30-18-11-16-24(30)25(31)20-12-7-5-8-13-20/h5-16,18,25H,3-4,17,19H2,1-2H3,(H,28,33)/t25-/m1/s1 |
| InChIKey | OHQFODFGHBJUIW-RUZDIDTESA-N |
| XLogP | 5.25 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |