C29H32FN5O — CID 92874516
(9R)-5-ethyl-9-(3-fluorophenyl)-N-(3-methylbutyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide (PubChem CID 92874516) has the molecular formula C29H32FN5O and a molecular weight of 485.61 g/mol. Its IUPAC name is (9R)-5-ethyl-9-(3-fluorophenyl)-N-(3-methylbutyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide.
| Compound Name | (9R)-5-ethyl-9-(3-fluorophenyl)-N-(3-methylbutyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92874516 |
| Molecular Formula | C29H32FN5O |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | (9R)-5-ethyl-9-(3-fluorophenyl)-N-(3-methylbutyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
| SMILES | CCc1nn(-c2ccccc2)c2c1CN(C(=O)NCCC(C)C)[C@H](c1cccc(F)c1)c1cccn1-2 |
| InChI | InChI=1S/C29H32FN5O/c1-4-25-24-19-34(29(36)31-16-15-20(2)3)27(21-10-8-11-22(30)18-21)26-14-9-17-33(26)28(24)35(32-25)23-12-6-5-7-13-23/h5-14,17-18,20,27H,4,15-16,19H2,1-3H3,(H,31,36)/t27-/m1/s1 |
| InChIKey | ITPRWFYTPDHTKT-HHHXNRCGSA-N |
| XLogP | 6.03 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |