C30H35N5O — CID 92874464
(9R)-9-(4-ethylphenyl)-5-methyl-N-(3-methylbutyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide (PubChem CID 92874464) has the molecular formula C30H35N5O and a molecular weight of 481.64 g/mol. Its IUPAC name is (9R)-9-(4-ethylphenyl)-5-methyl-N-(3-methylbutyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide.
| Compound Name | (9R)-9-(4-ethylphenyl)-5-methyl-N-(3-methylbutyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92874464 |
| Molecular Formula | C30H35N5O |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | (9R)-9-(4-ethylphenyl)-5-methyl-N-(3-methylbutyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
| SMILES | CCc1ccc([C@@H]2c3cccn3-c3c(c(C)nn3-c3ccccc3)CN2C(=O)NCCC(C)C)cc1 |
| InChI | InChI=1S/C30H35N5O/c1-5-23-13-15-24(16-14-23)28-27-12-9-19-33(27)29-26(20-34(28)30(36)31-18-17-21(2)3)22(4)32-35(29)25-10-7-6-8-11-25/h6-16,19,21,28H,5,17-18,20H2,1-4H3,(H,31,36)/t28-/m1/s1 |
| InChIKey | MNMZWVGUNNLLOH-MUUNZHRXSA-N |
| XLogP | 6.19 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |