C28H30ClN5O — CID 92873903
(9S)-9-(4-chlorophenyl)-5-methyl-N-(3-methylbutyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide (PubChem CID 92873903) has the molecular formula C28H30ClN5O and a molecular weight of 488.04 g/mol. Its IUPAC name is (9S)-9-(4-chlorophenyl)-5-methyl-N-(3-methylbutyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide.
| Compound Name | (9S)-9-(4-chlorophenyl)-5-methyl-N-(3-methylbutyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92873903 |
| Molecular Formula | C28H30ClN5O |
| Molecular Weight | 488.04 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | (9S)-9-(4-chlorophenyl)-5-methyl-N-(3-methylbutyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c2c1CN(C(=O)NCCC(C)C)[C@@H](c1ccc(Cl)cc1)c1cccn1-2 |
| InChI | InChI=1S/C28H30ClN5O/c1-19(2)15-16-30-28(35)33-18-24-20(3)31-34(23-8-5-4-6-9-23)27(24)32-17-7-10-25(32)26(33)21-11-13-22(29)14-12-21/h4-14,17,19,26H,15-16,18H2,1-3H3,(H,30,35)/t26-/m0/s1 |
| InChIKey | ALLYPOZBOAMZHT-SANMLTNESA-N |
| XLogP | 6.29 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.04 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |