C28H28ClN5O — CID 92892191
(9S)-9-(4-chlorophenyl)-N-cyclopentyl-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide (PubChem CID 92892191) has the molecular formula C28H28ClN5O and a molecular weight of 486.02 g/mol. Its IUPAC name is (9S)-9-(4-chlorophenyl)-N-cyclopentyl-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide.
| Compound Name | (9S)-9-(4-chlorophenyl)-N-cyclopentyl-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92892191 |
| Molecular Formula | C28H28ClN5O |
| Molecular Weight | 486.02 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | (9S)-9-(4-chlorophenyl)-N-cyclopentyl-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c2c1CN(C(=O)NC1CCCC1)[C@@H](c1ccc(Cl)cc1)c1cccn1-2 |
| InChI | InChI=1S/C28H28ClN5O/c1-19-24-18-33(28(35)30-22-8-5-6-9-22)26(20-13-15-21(29)16-14-20)25-12-7-17-32(25)27(24)34(31-19)23-10-3-2-4-11-23/h2-4,7,10-17,22,26H,5-6,8-9,18H2,1H3,(H,30,35)/t26-/m0/s1 |
| InChIKey | IQWDJNNWTZCSNW-SANMLTNESA-N |
| XLogP | 6.18 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.02 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |