C30H33N5O — CID 92874173
(9S)-N-cyclohexyl-5-ethyl-3,9-diphenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide (PubChem CID 92874173) has the molecular formula C30H33N5O and a molecular weight of 479.63 g/mol. Its IUPAC name is (9S)-N-cyclohexyl-5-ethyl-3,9-diphenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide.
| Compound Name | (9S)-N-cyclohexyl-5-ethyl-3,9-diphenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92874173 |
| Molecular Formula | C30H33N5O |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | (9S)-N-cyclohexyl-5-ethyl-3,9-diphenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
| SMILES | CCc1nn(-c2ccccc2)c2c1CN(C(=O)NC1CCCCC1)[C@@H](c1ccccc1)c1cccn1-2 |
| InChI | InChI=1S/C30H33N5O/c1-2-26-25-21-34(30(36)31-23-15-8-4-9-16-23)28(22-13-6-3-7-14-22)27-19-12-20-33(27)29(25)35(32-26)24-17-10-5-11-18-24/h3,5-7,10-14,17-20,23,28H,2,4,8-9,15-16,21H2,1H3,(H,31,36)/t28-/m0/s1 |
| InChIKey | SSVMXYCMDHBMGL-NDEPHWFRSA-N |
| XLogP | 6.17 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |