C32H31N5O — CID 92874161
(9S)-5-ethyl-N-[(4-methylphenyl)methyl]-3,9-diphenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide (PubChem CID 92874161) has the molecular formula C32H31N5O and a molecular weight of 501.63 g/mol. Its IUPAC name is (9S)-5-ethyl-N-[(4-methylphenyl)methyl]-3,9-diphenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide.
| Compound Name | (9S)-5-ethyl-N-[(4-methylphenyl)methyl]-3,9-diphenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92874161 |
| Molecular Formula | C32H31N5O |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | (9S)-5-ethyl-N-[(4-methylphenyl)methyl]-3,9-diphenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
| SMILES | CCc1nn(-c2ccccc2)c2c1CN(C(=O)NCc1ccc(C)cc1)[C@@H](c1ccccc1)c1cccn1-2 |
| InChI | InChI=1S/C32H31N5O/c1-3-28-27-22-36(32(38)33-21-24-18-16-23(2)17-19-24)30(25-11-6-4-7-12-25)29-15-10-20-35(29)31(27)37(34-28)26-13-8-5-9-14-26/h4-20,30H,3,21-22H2,1-2H3,(H,33,38)/t30-/m0/s1 |
| InChIKey | ROVOSOBCKQTJQB-PMERELPUSA-N |
| XLogP | 6.35 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |