C29H30FN5O — CID 46348101
N-cyclohexyl-9-(4-fluorophenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide (PubChem CID 46348101) has the molecular formula C29H30FN5O and a molecular weight of 483.59 g/mol. Its IUPAC name is N-cyclohexyl-9-(4-fluorophenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide.
| Compound Name | N-cyclohexyl-9-(4-fluorophenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 46348101 |
| Molecular Formula | C29H30FN5O |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | N-cyclohexyl-9-(4-fluorophenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c2c1CN(C(=O)NC1CCCCC1)C(c1ccc(F)cc1)c1cccn1-2 |
| InChI | InChI=1S/C29H30FN5O/c1-20-25-19-34(29(36)31-23-9-4-2-5-10-23)27(21-14-16-22(30)17-15-21)26-13-8-18-33(26)28(25)35(32-20)24-11-6-3-7-12-24/h3,6-8,11-18,23,27H,2,4-5,9-10,19H2,1H3,(H,31,36) |
| InChIKey | UUIDBPPWJOGWQB-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |