C27H29N5OS — CID 92874026
(9R)-5-methyl-9-(4-methylsulfanylphenyl)-3-phenyl-N-propan-2-yl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide (PubChem CID 92874026) has the molecular formula C27H29N5OS and a molecular weight of 471.63 g/mol. Its IUPAC name is (9R)-5-methyl-9-(4-methylsulfanylphenyl)-3-phenyl-N-propan-2-yl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide.
| Compound Name | (9R)-5-methyl-9-(4-methylsulfanylphenyl)-3-phenyl-N-propan-2-yl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92874026 |
| Molecular Formula | C27H29N5OS |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | (9R)-5-methyl-9-(4-methylsulfanylphenyl)-3-phenyl-N-propan-2-yl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
| SMILES | CSc1ccc([C@@H]2c3cccn3-c3c(c(C)nn3-c3ccccc3)CN2C(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C27H29N5OS/c1-18(2)28-27(33)31-17-23-19(3)29-32(21-9-6-5-7-10-21)26(23)30-16-8-11-24(30)25(31)20-12-14-22(34-4)15-13-20/h5-16,18,25H,17H2,1-4H3,(H,28,33)/t25-/m1/s1 |
| InChIKey | IXJZYQHDOVMGSD-RUZDIDTESA-N |
| XLogP | 5.72 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |