C33H34N6O — CID 50798009
9-[4-(dimethylamino)phenyl]-5-methyl-3-phenyl-N-(2-phenylethyl)-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide (PubChem CID 50798009) has the molecular formula C33H34N6O and a molecular weight of 530.68 g/mol. Its IUPAC name is 9-[4-(dimethylamino)phenyl]-5-methyl-3-phenyl-N-(2-phenylethyl)-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide.
| Compound Name | 9-[4-(dimethylamino)phenyl]-5-methyl-3-phenyl-N-(2-phenylethyl)-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 50798009 |
| Molecular Formula | C33H34N6O |
| Molecular Weight | 530.68 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | 9-[4-(dimethylamino)phenyl]-5-methyl-3-phenyl-N-(2-phenylethyl)-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c2c1CN(C(=O)NCCc1ccccc1)C(c1ccc(N(C)C)cc1)c1cccn1-2 |
| InChI | InChI=1S/C33H34N6O/c1-24-29-23-38(33(40)34-21-20-25-11-6-4-7-12-25)31(26-16-18-27(19-17-26)36(2)3)30-15-10-22-37(30)32(29)39(35-24)28-13-8-5-9-14-28/h4-19,22,31H,20-21,23H2,1-3H3,(H,34,40) |
| InChIKey | RTHURSFYGPPIKQ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 58.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.68 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|