C29H33N5O2 — CID 50798417
9-(3-methoxyphenyl)-5-methyl-N-(3-methylbutyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide (PubChem CID 50798417) has the molecular formula C29H33N5O2 and a molecular weight of 483.62 g/mol. Its IUPAC name is 9-(3-methoxyphenyl)-5-methyl-N-(3-methylbutyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide.
| Compound Name | 9-(3-methoxyphenyl)-5-methyl-N-(3-methylbutyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 50798417 |
| Molecular Formula | C29H33N5O2 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | 9-(3-methoxyphenyl)-5-methyl-N-(3-methylbutyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
| SMILES | COc1cccc(C2c3cccn3-c3c(c(C)nn3-c3ccccc3)CN2C(=O)NCCC(C)C)c1 |
| InChI | InChI=1S/C29H33N5O2/c1-20(2)15-16-30-29(35)33-19-25-21(3)31-34(23-11-6-5-7-12-23)28(25)32-17-9-14-26(32)27(33)22-10-8-13-24(18-22)36-4/h5-14,17-18,20,27H,15-16,19H2,1-4H3,(H,30,35) |
| InChIKey | WSLZSSUJMDPYBJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |