C29H27N5O3 — CID 92874772
(9R)-N-(furan-2-ylmethyl)-9-(3-methoxyphenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide (PubChem CID 92874772) has the molecular formula C29H27N5O3 and a molecular weight of 493.57 g/mol. Its IUPAC name is (9R)-N-(furan-2-ylmethyl)-9-(3-methoxyphenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide.
| Compound Name | (9R)-N-(furan-2-ylmethyl)-9-(3-methoxyphenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92874772 |
| Molecular Formula | C29H27N5O3 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | (9R)-N-(furan-2-ylmethyl)-9-(3-methoxyphenyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
| SMILES | COc1cccc([C@@H]2c3cccn3-c3c(c(C)nn3-c3ccccc3)CN2C(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C29H27N5O3/c1-20-25-19-33(29(35)30-18-24-13-8-16-37-24)27(21-9-6-12-23(17-21)36-2)26-14-7-15-32(26)28(25)34(31-20)22-10-4-3-5-11-22/h3-17,27H,18-19H2,1-2H3,(H,30,35)/t27-/m1/s1 |
| InChIKey | QREGSXCYRRDRHX-HHHXNRCGSA-N |
| XLogP | 5.39 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |