C28H24ClN5O2 — CID 92874603
(9S)-9-(3-chlorophenyl)-N-(furan-2-ylmethyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide (PubChem CID 92874603) has the molecular formula C28H24ClN5O2 and a molecular weight of 497.99 g/mol. Its IUPAC name is (9S)-9-(3-chlorophenyl)-N-(furan-2-ylmethyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide.
| Compound Name | (9S)-9-(3-chlorophenyl)-N-(furan-2-ylmethyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 92874603 |
| Molecular Formula | C28H24ClN5O2 |
| Molecular Weight | 497.99 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | (9S)-9-(3-chlorophenyl)-N-(furan-2-ylmethyl)-5-methyl-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c2c1CN(C(=O)NCc1ccco1)[C@@H](c1cccc(Cl)c1)c1cccn1-2 |
| InChI | InChI=1S/C28H24ClN5O2/c1-19-24-18-33(28(35)30-17-23-12-7-15-36-23)26(20-8-5-9-21(29)16-20)25-13-6-14-32(25)27(24)34(31-19)22-10-3-2-4-11-22/h2-16,26H,17-18H2,1H3,(H,30,35)/t26-/m0/s1 |
| InChIKey | IHGRVTWEYMLBOG-SANMLTNESA-N |
| XLogP | 6.03 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.99 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |