C30H33N5O3 — CID 92892528
ethyl 3-[[(9R)-5-ethyl-9-(3-methylphenyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carbonyl]amino]propanoate (PubChem CID 92892528) has the molecular formula C30H33N5O3 and a molecular weight of 511.63 g/mol. Its IUPAC name is ethyl 3-[[(9R)-5-ethyl-9-(3-methylphenyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carbonyl]amino]propanoate.
| Compound Name | ethyl 3-[[(9R)-5-ethyl-9-(3-methylphenyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 92892528 |
| Molecular Formula | C30H33N5O3 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | ethyl 3-[[(9R)-5-ethyl-9-(3-methylphenyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carbonyl]amino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)N1Cc2c(CC)nn(-c3ccccc3)c2-n2cccc2[C@H]1c1cccc(C)c1 |
| InChI | InChI=1S/C30H33N5O3/c1-4-25-24-20-34(30(37)31-17-16-27(36)38-5-2)28(22-12-9-11-21(3)19-22)26-15-10-18-33(26)29(24)35(32-25)23-13-7-6-8-14-23/h6-15,18-19,28H,4-5,16-17,20H2,1-3H3,(H,31,37)/t28-/m1/s1 |
| InChIKey | SAJMRXNEEFQXJA-MUUNZHRXSA-N |
| XLogP | 5.10 |
| TPSA | 81.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |