C31H26FN5O3 — CID 98225119
(9R)-N-(1,3-benzodioxol-5-yl)-5-ethyl-9-(3-fluorophenyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide (PubChem CID 98225119) has the molecular formula C31H26FN5O3 and a molecular weight of 535.58 g/mol. Its IUPAC name is (9R)-N-(1,3-benzodioxol-5-yl)-5-ethyl-9-(3-fluorophenyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide.
| Compound Name | (9R)-N-(1,3-benzodioxol-5-yl)-5-ethyl-9-(3-fluorophenyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 98225119 |
| Molecular Formula | C31H26FN5O3 |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | (9R)-N-(1,3-benzodioxol-5-yl)-5-ethyl-9-(3-fluorophenyl)-3-phenyl-1,3,4,8-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,10,12-tetraene-8-carboxamide |
| SMILES | CCc1nn(-c2ccccc2)c2c1CN(C(=O)Nc1ccc3c(c1)OCO3)[C@H](c1cccc(F)c1)c1cccn1-2 |
| InChI | InChI=1S/C31H26FN5O3/c1-2-25-24-18-36(31(38)33-22-13-14-27-28(17-22)40-19-39-27)29(20-8-6-9-21(32)16-20)26-12-7-15-35(26)30(24)37(34-25)23-10-4-3-5-11-23/h3-17,29H,2,18-19H2,1H3,(H,33,38)/t29-/m1/s1 |
| InChIKey | SKPUIWRECWSPGL-GDLZYMKVSA-N |
| XLogP | 6.23 |
| TPSA | 73.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |