C14H20IN3O — CID 98334021
N-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-4-iodo-1-methylpyrazole-3-carboxamide (PubChem CID 98334021) has the molecular formula C14H20IN3O and a molecular weight of 373.24 g/mol. Its IUPAC name is N-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-4-iodo-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-4-iodo-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 98334021 |
| Molecular Formula | C14H20IN3O |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | N-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-4-iodo-1-methylpyrazole-3-carboxamide |
| SMILES | C[C@@H](NC(=O)c1nn(C)cc1I)[C@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C14H20IN3O/c1-8(11-6-9-3-4-10(11)5-9)16-14(19)13-12(15)7-18(2)17-13/h7-11H,3-6H2,1-2H3,(H,16,19)/t8-,9+,10+,11-/m1/s1 |
| InChIKey | IFZNMBRSZLXSSZ-VPOLOUISSA-N |
| XLogP | 2.58 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|