C33H34N4O4 — CID 98334986
benzyl (4S)-4-[3-(4-butoxy-2-methylphenyl)-1-phenylpyrazol-4-yl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 98334986) has the molecular formula C33H34N4O4 and a molecular weight of 550.66 g/mol. Its IUPAC name is benzyl (4S)-4-[3-(4-butoxy-2-methylphenyl)-1-phenylpyrazol-4-yl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | benzyl (4S)-4-[3-(4-butoxy-2-methylphenyl)-1-phenylpyrazol-4-yl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 98334986 |
| Molecular Formula | C33H34N4O4 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | benzyl (4S)-4-[3-(4-butoxy-2-methylphenyl)-1-phenylpyrazol-4-yl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCCCOc1ccc(-c2nn(-c3ccccc3)cc2[C@@H]2NC(=O)NC(C)=C2C(=O)OCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C33H34N4O4/c1-4-5-18-40-26-16-17-27(22(2)19-26)30-28(20-37(36-30)25-14-10-7-11-15-25)31-29(23(3)34-33(39)35-31)32(38)41-21-24-12-8-6-9-13-24/h6-17,19-20,31H,4-5,18,21H2,1-3H3,(H2,34,35,39)/t31-/m0/s1 |
| InChIKey | SXSDPCVOIIGKOM-HKBQPEDESA-N |
| XLogP | 6.40 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|