C21H22Br2N2O3 — CID 98339227
(1R,2S,6S,7R,8R,9S)-8,9-dibromo-4-[4-(piperidine-1-carbonyl)phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 98339227) has the molecular formula C21H22Br2N2O3 and a molecular weight of 510.23 g/mol. Its IUPAC name is (1R,2S,6S,7R,8R,9S)-8,9-dibromo-4-[4-(piperidine-1-carbonyl)phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2S,6S,7R,8R,9S)-8,9-dibromo-4-[4-(piperidine-1-carbonyl)phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 98339227 |
| Molecular Formula | C21H22Br2N2O3 |
| Molecular Weight | 510.23 g/mol |
| Exact Mass | 508.00 |
| IUPAC Name | (1R,2S,6S,7R,8R,9S)-8,9-dibromo-4-[4-(piperidine-1-carbonyl)phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C(c1ccc(N2C(=O)[C@@H]3[C@H]4C[C@@H]([C@@H](Br)[C@H]4Br)[C@H]3C2=O)cc1)N1CCCCC1 |
| InChI | InChI=1S/C21H22Br2N2O3/c22-17-13-10-14(18(17)23)16-15(13)20(27)25(21(16)28)12-6-4-11(5-7-12)19(26)24-8-2-1-3-9-24/h4-7,13-18H,1-3,8-10H2/t13-,14-,15-,16-,17-,18+/m1/s1 |
| InChIKey | ITQBKQYPKGRVKC-KKFZBWNWSA-N |
| XLogP | 3.60 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.23 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|