C18H25N3O3 — CID 98345519
methyl (1S,2S,3R,4S)-3-[(3-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carbonyl)amino]bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 98345519) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is methyl (1S,2S,3R,4S)-3-[(3-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carbonyl)amino]bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | methyl (1S,2S,3R,4S)-3-[(3-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carbonyl)amino]bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 98345519 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | methyl (1S,2S,3R,4S)-3-[(3-methyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1-carbonyl)amino]bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H]2CC[C@@H](C2)[C@H]1NC(=O)c1nc(C)n2c1CCCC2 |
| InChI | InChI=1S/C18H25N3O3/c1-10-19-16(13-5-3-4-8-21(10)13)17(22)20-15-12-7-6-11(9-12)14(15)18(23)24-2/h11-12,14-15H,3-9H2,1-2H3,(H,20,22)/t11-,12-,14-,15+/m0/s1 |
| InChIKey | NPVARZJLIAHPKG-NZBPQXDJSA-N |
| XLogP | 1.85 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |