C15H16Cl2N2O3 — CID 98351784
methyl (1S,2S,3S,4S)-3-[(2,6-dichloropyridine-3-carbonyl)amino]bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 98351784) has the molecular formula C15H16Cl2N2O3 and a molecular weight of 343.21 g/mol. Its IUPAC name is methyl (1S,2S,3S,4S)-3-[(2,6-dichloropyridine-3-carbonyl)amino]bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | methyl (1S,2S,3S,4S)-3-[(2,6-dichloropyridine-3-carbonyl)amino]bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 98351784 |
| Molecular Formula | C15H16Cl2N2O3 |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | methyl (1S,2S,3S,4S)-3-[(2,6-dichloropyridine-3-carbonyl)amino]bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H]2CC[C@@H](C2)[C@@H]1NC(=O)c1ccc(Cl)nc1Cl |
| InChI | InChI=1S/C15H16Cl2N2O3/c1-22-15(21)11-7-2-3-8(6-7)12(11)19-14(20)9-4-5-10(16)18-13(9)17/h4-5,7-8,11-12H,2-3,6H2,1H3,(H,19,20)/t7-,8-,11-,12-/m0/s1 |
| InChIKey | FUVVPYKBXAQNTC-OSTYVCCYSA-N |
| XLogP | 2.71 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|