C17H20N2O3S — CID 98351769
ethyl 2-[[(1R,2R,4S)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]-cyclopropylamino]-1,3-thiazole-4-carboxylate (PubChem CID 98351769) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is ethyl 2-[[(1R,2R,4S)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]-cyclopropylamino]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[[(1R,2R,4S)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]-cyclopropylamino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 98351769 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | ethyl 2-[[(1R,2R,4S)-bicyclo[2.2.1]hept-5-ene-2-carbonyl]-cyclopropylamino]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(N(C(=O)[C@@H]2C[C@H]3C=C[C@H]2C3)C2CC2)n1 |
| InChI | InChI=1S/C17H20N2O3S/c1-2-22-16(21)14-9-23-17(18-14)19(12-5-6-12)15(20)13-8-10-3-4-11(13)7-10/h3-4,9-13H,2,5-8H2,1H3/t10-,11-,13+/m0/s1 |
| InChIKey | ZGLSRWVCQRCHCV-GMXVVIOVSA-N |
| XLogP | 3.03 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|