C21H16N4O6S — CID 98351972
(4E,5R)-4-[hydroxy-(4-methoxyphenyl)methylidene]-1-(5-methyl-1,3,4-thiadiazol-2-yl)-5-(4-nitrophenyl)pyrrolidine-2,3-dione (PubChem CID 98351972) has the molecular formula C21H16N4O6S and a molecular weight of 452.45 g/mol. Its IUPAC name is (4E,5R)-4-[hydroxy-(4-methoxyphenyl)methylidene]-1-(5-methyl-1,3,4-thiadiazol-2-yl)-5-(4-nitrophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E,5R)-4-[hydroxy-(4-methoxyphenyl)methylidene]-1-(5-methyl-1,3,4-thiadiazol-2-yl)-5-(4-nitrophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98351972 |
| Molecular Formula | C21H16N4O6S |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | (4E,5R)-4-[hydroxy-(4-methoxyphenyl)methylidene]-1-(5-methyl-1,3,4-thiadiazol-2-yl)-5-(4-nitrophenyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(/C(O)=C2\C(=O)C(=O)N(c3nnc(C)s3)[C@@H]2c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C21H16N4O6S/c1-11-22-23-21(32-11)24-17(12-3-7-14(8-4-12)25(29)30)16(19(27)20(24)28)18(26)13-5-9-15(31-2)10-6-13/h3-10,17,26H,1-2H3/b18-16+/t17-/m1/s1 |
| InChIKey | ZYMITXVWBHLENY-GROYHEBESA-N |
| XLogP | 3.39 |
| TPSA | 135.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|