C24H19N3O8S — CID 98378429
methyl 2-[(2S,3E)-3-[hydroxy-(4-methoxyphenyl)methylidene]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 98378429) has the molecular formula C24H19N3O8S and a molecular weight of 509.50 g/mol. Its IUPAC name is methyl 2-[(2S,3E)-3-[hydroxy-(4-methoxyphenyl)methylidene]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[(2S,3E)-3-[hydroxy-(4-methoxyphenyl)methylidene]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 98378429 |
| Molecular Formula | C24H19N3O8S |
| Molecular Weight | 509.50 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | methyl 2-[(2S,3E)-3-[hydroxy-(4-methoxyphenyl)methylidene]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(N2C(=O)C(=O)/C(=C(/O)c3ccc(OC)cc3)[C@@H]2c2ccc([N+](=O)[O-])cc2)nc1C |
| InChI | InChI=1S/C24H19N3O8S/c1-12-21(23(31)35-3)36-24(25-12)26-18(13-4-8-15(9-5-13)27(32)33)17(20(29)22(26)30)19(28)14-6-10-16(34-2)11-7-14/h4-11,18,28H,1-3H3/b19-17+/t18-/m0/s1 |
| InChIKey | OMGGICJFXPFVJP-GHNGSUTGSA-N |
| XLogP | 3.78 |
| TPSA | 149.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|