C17H19N3O2S — CID 98361335
(2R)-2-(5-methylthiophene-2-carbonyl)-3-oxo-5-(1,3,5-trimethylpyrazol-4-yl)pentanenitrile (PubChem CID 98361335) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is (2R)-2-(5-methylthiophene-2-carbonyl)-3-oxo-5-(1,3,5-trimethylpyrazol-4-yl)pentanenitrile.
| Compound Name | (2R)-2-(5-methylthiophene-2-carbonyl)-3-oxo-5-(1,3,5-trimethylpyrazol-4-yl)pentanenitrile |
|---|---|
| PubChem CID | 98361335 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | (2R)-2-(5-methylthiophene-2-carbonyl)-3-oxo-5-(1,3,5-trimethylpyrazol-4-yl)pentanenitrile |
| SMILES | Cc1ccc(C(=O)[C@H](C#N)C(=O)CCc2c(C)nn(C)c2C)s1 |
| InChI | InChI=1S/C17H19N3O2S/c1-10-5-8-16(23-10)17(22)14(9-18)15(21)7-6-13-11(2)19-20(4)12(13)3/h5,8,14H,6-7H2,1-4H3/t14-/m1/s1 |
| InChIKey | LMCBAEYPPLGFPL-CQSZACIVSA-N |
| XLogP | 2.93 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|