C17H20N2O4 — CID 78832286
2,3-dihydro-1,4-benzodioxin-6-yl 3-(1,3,5-trimethylpyrazol-4-yl)propanoate (PubChem CID 78832286) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-yl 3-(1,3,5-trimethylpyrazol-4-yl)propanoate.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-yl 3-(1,3,5-trimethylpyrazol-4-yl)propanoate |
|---|---|
| PubChem CID | 78832286 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-yl 3-(1,3,5-trimethylpyrazol-4-yl)propanoate |
| SMILES | Cc1nn(C)c(C)c1CCC(=O)Oc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H20N2O4/c1-11-14(12(2)19(3)18-11)5-7-17(20)23-13-4-6-15-16(10-13)22-9-8-21-15/h4,6,10H,5,7-9H2,1-3H3 |
| InChIKey | IIVCMCNXWRQPQR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|