C17H15BrO4 — CID 78829795
2,3-dihydro-1,4-benzodioxin-6-yl 3-(3-bromophenyl)propanoate (PubChem CID 78829795) has the molecular formula C17H15BrO4 and a molecular weight of 363.21 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-yl 3-(3-bromophenyl)propanoate.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-yl 3-(3-bromophenyl)propanoate |
|---|---|
| PubChem CID | 78829795 |
| Molecular Formula | C17H15BrO4 |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-yl 3-(3-bromophenyl)propanoate |
| SMILES | O=C(CCc1cccc(Br)c1)Oc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H15BrO4/c18-13-3-1-2-12(10-13)4-7-17(19)22-14-5-6-15-16(11-14)21-9-8-20-15/h1-3,5-6,10-11H,4,7-9H2 |
| InChIKey | FBIODTJBUAXVRG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|