C12H11IN2O2 — CID 98361770
(2S)-2-cyano-3-(3-iodo-4-methylphenyl)-N-methyl-3-oxopropanamide (PubChem CID 98361770) has the molecular formula C12H11IN2O2 and a molecular weight of 342.14 g/mol. Its IUPAC name is (2S)-2-cyano-3-(3-iodo-4-methylphenyl)-N-methyl-3-oxopropanamide.
| Compound Name | (2S)-2-cyano-3-(3-iodo-4-methylphenyl)-N-methyl-3-oxopropanamide |
|---|---|
| PubChem CID | 98361770 |
| Molecular Formula | C12H11IN2O2 |
| Molecular Weight | 342.14 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | (2S)-2-cyano-3-(3-iodo-4-methylphenyl)-N-methyl-3-oxopropanamide |
| SMILES | CNC(=O)[C@@H](C#N)C(=O)c1ccc(C)c(I)c1 |
| InChI | InChI=1S/C12H11IN2O2/c1-7-3-4-8(5-10(7)13)11(16)9(6-14)12(17)15-2/h3-5,9H,1-2H3,(H,15,17)/t9-/m0/s1 |
| InChIKey | WVMPOKHLJUWSDK-VIFPVBQESA-N |
| XLogP | 1.67 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.14 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|