C22H36N2O4 — CID 98364011
(1S,3R,4S)-3-hydroxy-N'-[(1R,3R,4R)-3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carbonyl]-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carbohydrazide (PubChem CID 98364011) has the molecular formula C22H36N2O4 and a molecular weight of 392.54 g/mol. Its IUPAC name is (1S,3R,4S)-3-hydroxy-N'-[(1R,3R,4R)-3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carbonyl]-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carbohydrazide.
| Compound Name | (1S,3R,4S)-3-hydroxy-N'-[(1R,3R,4R)-3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carbonyl]-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carbohydrazide |
|---|---|
| PubChem CID | 98364011 |
| Molecular Formula | C22H36N2O4 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | (1S,3R,4S)-3-hydroxy-N'-[(1R,3R,4R)-3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carbonyl]-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carbohydrazide |
| SMILES | CC1(C)[C@@]2(C(=O)NNC(=O)[C@@]34CC[C@](C)([C@H](O)C3)C4(C)C)CC[C@@]1(C)[C@H](O)C2 |
| InChI | InChI=1S/C22H36N2O4/c1-17(2)19(5)7-9-21(17,11-13(19)25)15(27)23-24-16(28)22-10-8-20(6,14(26)12-22)18(22,3)4/h13-14,25-26H,7-12H2,1-6H3,(H,23,27)(H,24,28)/t13-,14-,19-,20+,21-,22+/m1/s1 |
| InChIKey | KTHKFBXSXFSTAX-GJGHLTEWSA-N |
| XLogP | 2.29 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|