C18H22O4 — CID 176891968
benzoyl 3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 176891968) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is benzoyl 3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | benzoyl 3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 176891968 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | benzoyl 3-hydroxy-4,7,7-trimethylbicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | CC12CCC(C(=O)OC(=O)c3ccccc3)(CC1O)C2(C)C |
| InChI | InChI=1S/C18H22O4/c1-16(2)17(3)9-10-18(16,11-13(17)19)15(21)22-14(20)12-7-5-4-6-8-12/h4-8,13,19H,9-11H2,1-3H3 |
| InChIKey | BYUQJMAVYSFNCF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|